C27H33F3N4O — CID 145092982
(Z)-1-[4-[[4-methyl-2-(methylideneamino)oxyphenyl]methyl]piperidin-1-yl]-3-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]but-2-ene-2,3-diamine (PubChem CID 145092982) has the molecular formula C27H33F3N4O and a molecular weight of 486.58 g/mol. Its IUPAC name is (Z)-1-[4-[[4-methyl-2-(methylideneamino)oxyphenyl]methyl]piperidin-1-yl]-3-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]but-2-ene-2,3-diamine.
| Compound Name | (Z)-1-[4-[[4-methyl-2-(methylideneamino)oxyphenyl]methyl]piperidin-1-yl]-3-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]but-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 145092982 |
| Molecular Formula | C27H33F3N4O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (Z)-1-[4-[[4-methyl-2-(methylideneamino)oxyphenyl]methyl]piperidin-1-yl]-3-N-[1-[4-(trifluoromethyl)phenyl]ethenyl]but-2-ene-2,3-diamine |
| SMILES | C=NOc1cc(C)ccc1CC1CCN(C/C(N)=C(\C)NC(=C)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H33F3N4O/c1-18-5-6-23(26(15-18)35-32-4)16-21-11-13-34(14-12-21)17-25(31)20(3)33-19(2)22-7-9-24(10-8-22)27(28,29)30/h5-10,15,21,33H,2,4,11-14,16-17,31H2,1,3H3/b25-20- |
| InChIKey | CENTXDWGNRWTMJ-QQTULTPQSA-N |
| XLogP | 5.71 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|