About CID 145093303
CID 145093303 (PubChem CID 145093303) has the molecular formula C21H13B3Cl2N2O2
and a molecular weight of 428.69 g/mol.
Molecular Properties
| Compound Name | CID 145093303 |
| PubChem CID | 145093303 |
| Molecular Formula | C21H13B3Cl2N2O2 |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1ccc(-c2ccc(-c3nc(-c4ccc(Cl)cc4)c(C)[nH]3)o2)cc1Cl |
| InChI | InChI=1S/C21H13B3Cl2N2O2/c1-11-19(12-2-5-14(25)6-3-12)28-20(27-11)18-9-8-16(29-18)13-4-7-17(15(26)10-13)30-21(22,23)24/h2-10H,1H3,(H,27,28) |
| InChIKey | IBHNKEKEKQOLRD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 145093303 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145093303?
The IUPAC name of CID 145093303 (CID 145093303) is not available.
What is the SMILES notation for CID 145093303?
The canonical SMILES for CID 145093303 is [B]C([B])([B])Oc1ccc(-c2ccc(-c3nc(-c4ccc(Cl)cc4)c(C)[nH]3)o2)cc1Cl.
What is the InChIKey of CID 145093303?
The InChIKey is IBHNKEKEKQOLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13B3Cl2N2O2/c1-11-19(12-2-5-14(25)6-3-12)28-20(27-11)18-9-8-16(29-18)13-4-7-17(15(26)10-13)30-21(22,23)24/h2-10H,1H3,(H,27,28).
What are the key properties of CID 145093303?
CID 145093303 has a molecular weight of 428.69 g/mol, XLogP of 5.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145093303 is sourced from PubChem (CID 145093303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).