About ethane;(3Z)-2-iminohexa-3,5-dienimidamide
ethane;(3Z)-2-iminohexa-3,5-dienimidamide (PubChem CID 145093635) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is ethane;(3Z)-2-iminohexa-3,5-dienimidamide.
Molecular Properties
| Compound Name | ethane;(3Z)-2-iminohexa-3,5-dienimidamide |
| PubChem CID | 145093635 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | ethane;(3Z)-2-iminohexa-3,5-dienimidamide |
| SMILES | CC.[H]/N=C(N)/C(/C=C\C=C)=N/[H] |
| InChI | InChI=1S/C6H9N3.C2H6/c1-2-3-4-5(7)6(8)9;1-2/h2-4,7H,1H2,(H3,8,9);1-2H3/b4-3-,7-5+; |
| InChIKey | ZXQJWIPQFOAIJB-LMMDHOJISA-N |
| XLogP | 1.71 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-2-iminohexa-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-2-iminohexa-3,5-dienimidamide?
The IUPAC name of ethane;(3Z)-2-iminohexa-3,5-dienimidamide (CID 145093635) is ethane;(3Z)-2-iminohexa-3,5-dienimidamide.
What is the SMILES notation for ethane;(3Z)-2-iminohexa-3,5-dienimidamide?
The canonical SMILES for ethane;(3Z)-2-iminohexa-3,5-dienimidamide is CC.[H]/N=C(N)/C(/C=C\C=C)=N/[H].
What is the InChIKey of ethane;(3Z)-2-iminohexa-3,5-dienimidamide?
The InChIKey is ZXQJWIPQFOAIJB-LMMDHOJISA-N. The full InChI is InChI=1S/C6H9N3.C2H6/c1-2-3-4-5(7)6(8)9;1-2/h2-4,7H,1H2,(H3,8,9);1-2H3/b4-3-,7-5+;.
What are the key properties of ethane;(3Z)-2-iminohexa-3,5-dienimidamide?
ethane;(3Z)-2-iminohexa-3,5-dienimidamide has a molecular weight of 153.23 g/mol, XLogP of 1.71, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-2-iminohexa-3,5-dienimidamide is sourced from PubChem (CID 145093635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).