About 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene
4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 145093850) has the molecular formula C22H17N3
and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 145093850 |
| Molecular Formula | C22H17N3 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | C1=NC2CC2C=C1c1ccc(-c2cc(-c3ccccc3)ncn2)cc1 |
| InChI | InChI=1S/C22H17N3/c1-2-4-16(5-3-1)21-12-22(25-14-24-21)17-8-6-15(7-9-17)19-10-18-11-20(18)23-13-19/h1-10,12-14,18,20H,11H2 |
| InChIKey | IVWOBKAAVWCDAA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene (CID 145093850) is 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene is C1=NC2CC2C=C1c1ccc(-c2cc(-c3ccccc3)ncn2)cc1.
What is the InChIKey of 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is IVWOBKAAVWCDAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3/c1-2-4-16(5-3-1)21-12-22(25-14-24-21)17-8-6-15(7-9-17)19-10-18-11-20(18)23-13-19/h1-10,12-14,18,20H,11H2.
What are the key properties of 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene?
4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 323.40 g/mol, XLogP of 4.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(6-phenylpyrimidin-4-yl)phenyl]-2-azabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 145093850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).