C41H27N3O5 — CID 145093934
6-[4-(3-phenanthren-9-ylphenyl)-5-(3-pyridin-3-ylphenyl)pyrimidin-2-yl]benzene-1,2,3,4,5-pentol (PubChem CID 145093934) has the molecular formula C41H27N3O5 and a molecular weight of 641.68 g/mol. Its IUPAC name is 6-[4-(3-phenanthren-9-ylphenyl)-5-(3-pyridin-3-ylphenyl)pyrimidin-2-yl]benzene-1,2,3,4,5-pentol.
| Compound Name | 6-[4-(3-phenanthren-9-ylphenyl)-5-(3-pyridin-3-ylphenyl)pyrimidin-2-yl]benzene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 145093934 |
| Molecular Formula | C41H27N3O5 |
| Molecular Weight | 641.68 g/mol |
| Exact Mass | 641.20 |
| IUPAC Name | 6-[4-(3-phenanthren-9-ylphenyl)-5-(3-pyridin-3-ylphenyl)pyrimidin-2-yl]benzene-1,2,3,4,5-pentol |
| SMILES | Oc1c(O)c(O)c(-c2ncc(-c3cccc(-c4cccnc4)c3)c(-c3cccc(-c4cc5ccccc5c5ccccc45)c3)n2)c(O)c1O |
| InChI | InChI=1S/C41H27N3O5/c45-36-34(37(46)39(48)40(49)38(36)47)41-43-22-33(25-11-5-9-23(18-25)28-13-7-17-42-21-28)35(44-41)27-12-6-10-24(19-27)32-20-26-8-1-2-14-29(26)30-15-3-4-16-31(30)32/h1-22,45-49H |
| InChIKey | VARFBJTXHLCNDB-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.68 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|