About N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate
N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 145094041) has the molecular formula C9H18N4O7S
and a molecular weight of 326.33 g/mol. Its IUPAC name is N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
Molecular Properties
| Compound Name | N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| PubChem CID | 145094041 |
| Molecular Formula | C9H18N4O7S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NCCONC=O.O=C1N2CCC[C@H](C2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C6H10N2O5S.C3H8N2O2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;4-1-2-7-5-3-6/h5H,1-4H2,(H,10,11,12);3H,1-2,4H2,(H,5,6)/t5-;/m1./s1 |
| InChIKey | PPPPGVUSMSSIOX-NUBCRITNSA-N |
| XLogP | -1.76 |
| TPSA | 151.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate?
The IUPAC name of N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (CID 145094041) is N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
What is the SMILES notation for N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate?
The canonical SMILES for N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate is NCCONC=O.O=C1N2CCC[C@H](C2)N1OS(=O)(=O)O.
What is the InChIKey of N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate?
The InChIKey is PPPPGVUSMSSIOX-NUBCRITNSA-N. The full InChI is InChI=1S/C6H10N2O5S.C3H8N2O2/c9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;4-1-2-7-5-3-6/h5H,1-4H2,(H,10,11,12);3H,1-2,4H2,(H,5,6)/t5-;/m1./s1.
What are the key properties of N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate?
N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate has a molecular weight of 326.33 g/mol, XLogP of -1.76, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethoxy)formamide;[(5R)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate is sourced from PubChem (CID 145094041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).