C27H38N4O5 — CID 145094691
[8-[1,4-dioxan-2-ylmethyl(methyl)amino]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone;molecular hydrogen (PubChem CID 145094691) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is [8-[1,4-dioxan-2-ylmethyl(methyl)amino]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone;molecular hydrogen.
| Compound Name | [8-[1,4-dioxan-2-ylmethyl(methyl)amino]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone;molecular hydrogen |
|---|---|
| PubChem CID | 145094691 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [8-[1,4-dioxan-2-ylmethyl(methyl)amino]-5,11-dihydropyrido[3,2-c][1,5]benzodiazepin-6-yl]-[(2R,5S)-5-propan-2-yloxyoxan-2-yl]methanone;molecular hydrogen |
| SMILES | CC(C)O[C@H]1CC[C@H](C(=O)N2Cc3cccnc3Nc3ccc(N(C)CC4COCCO4)cc32)OC1.[H][H] |
| InChI | InChI=1S/C27H36N4O5.H2/c1-18(2)36-21-7-9-25(35-17-21)27(32)31-14-19-5-4-10-28-26(19)29-23-8-6-20(13-24(23)31)30(3)15-22-16-33-11-12-34-22;/h4-6,8,10,13,18,21-22,25H,7,9,11-12,14-17H2,1-3H3,(H,28,29);1H/t21-,22?,25+;/m0./s1 |
| InChIKey | RMJUNQZGOXIZRO-SAXUBJRESA-N |
| XLogP | 3.74 |
| TPSA | 85.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |