C14H20BFN2O2 — CID 145094827
3-fluoro-2-methanimidoyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 145094827) has the molecular formula C14H20BFN2O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 3-fluoro-2-methanimidoyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 3-fluoro-2-methanimidoyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 145094827 |
| Molecular Formula | C14H20BFN2O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 3-fluoro-2-methanimidoyl-N-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | [H]/N=C/c1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1NC |
| InChI | InChI=1S/C14H20BFN2O2/c1-13(2)14(3,4)20-15(19-13)9-6-11(16)10(8-17)12(7-9)18-5/h6-8,17-18H,1-5H3/b17-8+ |
| InChIKey | MQPNCNGUIZTKGF-CAOOACKPSA-N |
| XLogP | 2.16 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|