C14H22FN3O2 — CID 145095492
tert-butyl 6-[(1-amino-2-fluoroprop-2-enylidene)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 145095492) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is tert-butyl 6-[(1-amino-2-fluoroprop-2-enylidene)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[(1-amino-2-fluoroprop-2-enylidene)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 145095492 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | tert-butyl 6-[(1-amino-2-fluoroprop-2-enylidene)amino]-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | C=C(F)/C(N)=N\C1CC2CC1N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C14H22FN3O2/c1-8(15)12(16)17-10-5-9-6-11(10)18(7-9)13(19)20-14(2,3)4/h9-11H,1,5-7H2,2-4H3,(H2,16,17) |
| InChIKey | QULDRQUGHNMSBL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|