C26H40O3 — CID 145095735
ethane;1-(13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone (PubChem CID 145095735) has the molecular formula C26H40O3 and a molecular weight of 400.60 g/mol. Its IUPAC name is ethane;1-(13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone.
| Compound Name | ethane;1-(13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone |
|---|---|
| PubChem CID | 145095735 |
| Molecular Formula | C26H40O3 |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.30 |
| IUPAC Name | ethane;1-(13'-methylspiro[1,3-dioxolane-2,3'-2,4,6,7,8,12,14,15-octahydro-1H-cyclopenta[a]phenanthrene]-17'-yl)ethanone |
| SMILES | CC.CC.CC(=O)C1=CCC2C3CCC4=C(CCC5(C4)OCCO5)C3=CCC12C |
| InChI | InChI=1S/C22H28O3.2C2H6/c1-14(23)19-5-6-20-18-4-3-15-13-22(24-11-12-25-22)10-8-16(15)17(18)7-9-21(19,20)2;2*1-2/h5,7,18,20H,3-4,6,8-13H2,1-2H3;2*1-2H3 |
| InChIKey | UQBJZHMABVAJSM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |