C24H30F3N5O2S — CID 145096551
N-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-(5-methyl-1,3-thiazol-2-yl)-5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]oxybenzamide (PubChem CID 145096551) has the molecular formula C24H30F3N5O2S and a molecular weight of 509.60 g/mol. Its IUPAC name is N-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-(5-methyl-1,3-thiazol-2-yl)-5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]oxybenzamide.
| Compound Name | N-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-(5-methyl-1,3-thiazol-2-yl)-5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 145096551 |
| Molecular Formula | C24H30F3N5O2S |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | N-[(2Z,4Z)-2,5-diaminohexa-2,4-dienyl]-3-(5-methyl-1,3-thiazol-2-yl)-5-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]oxybenzamide |
| SMILES | C/C(N)=C/C=C(\N)CNC(=O)c1cc(OC2CCN(CC(F)(F)F)CC2)cc(-c2ncc(C)s2)c1 |
| InChI | InChI=1S/C24H30F3N5O2S/c1-15(28)3-4-19(29)13-30-22(33)17-9-18(23-31-12-16(2)35-23)11-21(10-17)34-20-5-7-32(8-6-20)14-24(25,26)27/h3-4,9-12,20H,5-8,13-14,28-29H2,1-2H3,(H,30,33)/b15-3-,19-4- |
| InChIKey | BFEGHCSHZMKBLM-HFPBZCCOSA-N |
| XLogP | 3.96 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|