About 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone
2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone (PubChem CID 145096965) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone.
Molecular Properties
| Compound Name | 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone |
| PubChem CID | 145096965 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone |
| SMILES | C=c1nc(C)n(CC(=O)N2CCOCC2)c1=C |
| InChI | InChI=1S/C12H17N3O2/c1-9-10(2)15(11(3)13-9)8-12(16)14-4-6-17-7-5-14/h1-2,4-8H2,3H3 |
| InChIKey | NIZYTGJOMXOMKB-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone?
The IUPAC name of 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone (CID 145096965) is 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone.
What is the SMILES notation for 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone?
The canonical SMILES for 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone is C=c1nc(C)n(CC(=O)N2CCOCC2)c1=C.
What is the InChIKey of 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone?
The InChIKey is NIZYTGJOMXOMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-9-10(2)15(11(3)13-9)8-12(16)14-4-6-17-7-5-14/h1-2,4-8H2,3H3.
What are the key properties of 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone?
2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone has a molecular weight of 235.29 g/mol, XLogP of -1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-4,5-dimethylideneimidazol-1-yl)-1-morpholin-4-ylethanone is sourced from PubChem (CID 145096965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).