C22H29N7OS2 — CID 145097085
5-[3-methyl-2-[(4-methylsulfanylpiperazin-1-yl)methyl]-7-morpholin-4-ylthieno[2,3-c]pyridin-5-yl]pyrimidin-2-amine (PubChem CID 145097085) has the molecular formula C22H29N7OS2 and a molecular weight of 471.66 g/mol. Its IUPAC name is 5-[3-methyl-2-[(4-methylsulfanylpiperazin-1-yl)methyl]-7-morpholin-4-ylthieno[2,3-c]pyridin-5-yl]pyrimidin-2-amine.
| Compound Name | 5-[3-methyl-2-[(4-methylsulfanylpiperazin-1-yl)methyl]-7-morpholin-4-ylthieno[2,3-c]pyridin-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145097085 |
| Molecular Formula | C22H29N7OS2 |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-[3-methyl-2-[(4-methylsulfanylpiperazin-1-yl)methyl]-7-morpholin-4-ylthieno[2,3-c]pyridin-5-yl]pyrimidin-2-amine |
| SMILES | CSN1CCN(Cc2sc3c(N4CCOCC4)nc(-c4cnc(N)nc4)cc3c2C)CC1 |
| InChI | InChI=1S/C22H29N7OS2/c1-15-17-11-18(16-12-24-22(23)25-13-16)26-21(28-7-9-30-10-8-28)20(17)32-19(15)14-27-3-5-29(31-2)6-4-27/h11-13H,3-10,14H2,1-2H3,(H2,23,24,25) |
| InChIKey | VPLIGYRKUKSWIL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|