C39H48N4S — CID 145097491
12-[4-(6-cyclohexa-1,5-dien-1-yl-2-cyclohex-2-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)cyclohexyl]-3,4,6,6a,6b,10a,11a,11b-octahydro-[1]benzothiolo[2,3-a]carbazole (PubChem CID 145097491) has the molecular formula C39H48N4S and a molecular weight of 604.91 g/mol. Its IUPAC name is 12-[4-(6-cyclohexa-1,5-dien-1-yl-2-cyclohex-2-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)cyclohexyl]-3,4,6,6a,6b,10a,11a,11b-octahydro-[1]benzothiolo[2,3-a]carbazole.
| Compound Name | 12-[4-(6-cyclohexa-1,5-dien-1-yl-2-cyclohex-2-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)cyclohexyl]-3,4,6,6a,6b,10a,11a,11b-octahydro-[1]benzothiolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 145097491 |
| Molecular Formula | C39H48N4S |
| Molecular Weight | 604.91 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | 12-[4-(6-cyclohexa-1,5-dien-1-yl-2-cyclohex-2-en-1-yl-1,2,3,4-tetrahydro-1,3,5-triazin-4-yl)cyclohexyl]-3,4,6,6a,6b,10a,11a,11b-octahydro-[1]benzothiolo[2,3-a]carbazole |
| SMILES | C1=CC2SC3C(CC=C4C5=C(C=CCC5)N(C5CCC(C6N=C(C7=CCCC=C7)NC(C7C=CCCC7)N6)CC5)C43)C2C=C1 |
| InChI | InChI=1S/C39H48N4S/c1-3-11-25(12-4-1)37-40-38(26-13-5-2-6-14-26)42-39(41-37)27-19-21-28(22-20-27)43-33-17-9-7-15-29(33)31-23-24-32-30-16-8-10-18-34(30)44-36(32)35(31)43/h3,5,8-13,16-18,23,26-28,30,32,34-36,38-39,42H,1-2,4,6-7,14-15,19-22,24H2,(H,40,41) |
| InChIKey | ZOFRPKZHDJQQMU-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.91 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|