C31H55NO — CID 145097662
4-[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]morpholine (PubChem CID 145097662) has the molecular formula C31H55NO and a molecular weight of 457.79 g/mol. Its IUPAC name is 4-[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]morpholine.
| Compound Name | 4-[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]morpholine |
|---|---|
| PubChem CID | 145097662 |
| Molecular Formula | C31H55NO |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 457.43 |
| IUPAC Name | 4-[10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]morpholine |
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CCC4CC(N5CCOCC5)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C31H55NO/c1-22(2)7-6-8-23(3)27-11-12-28-26-10-9-24-21-25(32-17-19-33-20-18-32)13-15-30(24,4)29(26)14-16-31(27,28)5/h22-29H,6-21H2,1-5H3/t23-,24?,25?,26?,27?,28?,29?,30?,31?/m1/s1 |
| InChIKey | BMVINZSYFMOUBA-PDDZQFTFSA-N |
| XLogP | 7.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |