C25H19Cl3N6O2 — CID 145098010
2-chloro-N-[(2R)-2-(5,8-dichloro-4-oxo-3H-quinazolin-2-yl)-2-phenylethyl]-4-(dimethanimidoylamino)benzamide (PubChem CID 145098010) has the molecular formula C25H19Cl3N6O2 and a molecular weight of 541.83 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-2-(5,8-dichloro-4-oxo-3H-quinazolin-2-yl)-2-phenylethyl]-4-(dimethanimidoylamino)benzamide.
| Compound Name | 2-chloro-N-[(2R)-2-(5,8-dichloro-4-oxo-3H-quinazolin-2-yl)-2-phenylethyl]-4-(dimethanimidoylamino)benzamide |
|---|---|
| PubChem CID | 145098010 |
| Molecular Formula | C25H19Cl3N6O2 |
| Molecular Weight | 541.83 g/mol |
| Exact Mass | 540.06 |
| IUPAC Name | 2-chloro-N-[(2R)-2-(5,8-dichloro-4-oxo-3H-quinazolin-2-yl)-2-phenylethyl]-4-(dimethanimidoylamino)benzamide |
| SMILES | [H]/N=C/N(/C=N/[H])c1ccc(C(=O)NC[C@@H](c2ccccc2)c2nc3c(Cl)ccc(Cl)c3c(=O)[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl3N6O2/c26-18-8-9-19(27)22-21(18)25(36)33-23(32-22)17(14-4-2-1-3-5-14)11-31-24(35)16-7-6-15(10-20(16)28)34(12-29)13-30/h1-10,12-13,17,29-30H,11H2,(H,31,35)(H,32,33,36)/b29-12+,30-13+/t17-/m0/s1 |
| InChIKey | VOWCWLMOVLWWPD-ZNVCIZSRSA-N |
| XLogP | 5.47 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.83 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|