C28H52O2 — CID 145098045
ethane;(10S,13S)-17-[(1S)-1-hydroxyheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 145098045) has the molecular formula C28H52O2 and a molecular weight of 420.72 g/mol. Its IUPAC name is ethane;(10S,13S)-17-[(1S)-1-hydroxyheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | ethane;(10S,13S)-17-[(1S)-1-hydroxyheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 145098045 |
| Molecular Formula | C28H52O2 |
| Molecular Weight | 420.72 g/mol |
| Exact Mass | 420.40 |
| IUPAC Name | ethane;(10S,13S)-17-[(1S)-1-hydroxyheptyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC.CCCCCC[C@H](O)C1CCC2C3CCC4CC(O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C26H46O2.C2H6/c1-4-5-6-7-8-24(28)23-12-11-21-20-10-9-18-17-19(27)13-15-25(18,2)22(20)14-16-26(21,23)3;1-2/h18-24,27-28H,4-17H2,1-3H3;1-2H3/t18?,19?,20?,21?,22?,23?,24-,25-,26-;/m0./s1 |
| InChIKey | SKAMRMKBQBVCRO-SJXJTJLCSA-N |
| XLogP | 7.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|