C38H38N4O5S2 — CID 145098820
4-benzoyl-N-[3-[2-[5-[(Z)-[3-(3-methylbut-3-enyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide;methane;molecular hydrogen (PubChem CID 145098820) has the molecular formula C38H38N4O5S2 and a molecular weight of 694.88 g/mol. Its IUPAC name is 4-benzoyl-N-[3-[2-[5-[(Z)-[3-(3-methylbut-3-enyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide;methane;molecular hydrogen.
| Compound Name | 4-benzoyl-N-[3-[2-[5-[(Z)-[3-(3-methylbut-3-enyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide;methane;molecular hydrogen |
|---|---|
| PubChem CID | 145098820 |
| Molecular Formula | C38H38N4O5S2 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | 4-benzoyl-N-[3-[2-[5-[(Z)-[3-(3-methylbut-3-enyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]sulfanylbenzimidazol-1-yl]propyl]benzamide;methane;molecular hydrogen |
| SMILES | C.C=C(C)CCN1C(=O)S/C(=C\c2ccc(Sc3nc4ccccc4n3CCCNC(=O)c3ccc(C(=O)c4ccccc4)cc3)o2)C1=O.[H][H] |
| InChI | InChI=1S/C37H32N4O5S2.CH4.H2/c1-24(2)19-22-41-35(44)31(47-37(41)45)23-28-17-18-32(46-28)48-36-39-29-11-6-7-12-30(29)40(36)21-8-20-38-34(43)27-15-13-26(14-16-27)33(42)25-9-4-3-5-10-25;;/h3-7,9-18,23H,1,8,19-22H2,2H3,(H,38,43);1H4;1H/b31-23-;; |
| InChIKey | MIIQRDKFDAGHQE-BHMXDPPTSA-N |
| XLogP | 8.72 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|