C39H48N4O4S — CID 145098907
5-tert-butylthiophene-2-carboxamide;(2R)-2-[3-[4-[5-[4-(4-ethylcyclohexyl)phenyl]pyrimidin-2-yl]phenyl]propanoylamino]propanoic acid (PubChem CID 145098907) has the molecular formula C39H48N4O4S and a molecular weight of 668.90 g/mol. Its IUPAC name is 5-tert-butylthiophene-2-carboxamide;(2R)-2-[3-[4-[5-[4-(4-ethylcyclohexyl)phenyl]pyrimidin-2-yl]phenyl]propanoylamino]propanoic acid.
| Compound Name | 5-tert-butylthiophene-2-carboxamide;(2R)-2-[3-[4-[5-[4-(4-ethylcyclohexyl)phenyl]pyrimidin-2-yl]phenyl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 145098907 |
| Molecular Formula | C39H48N4O4S |
| Molecular Weight | 668.90 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | 5-tert-butylthiophene-2-carboxamide;(2R)-2-[3-[4-[5-[4-(4-ethylcyclohexyl)phenyl]pyrimidin-2-yl]phenyl]propanoylamino]propanoic acid |
| SMILES | CC(C)(C)c1ccc(C(N)=O)s1.CCC1CCC(c2ccc(-c3cnc(-c4ccc(CCC(=O)N[C@H](C)C(=O)O)cc4)nc3)cc2)CC1 |
| InChI | InChI=1S/C30H35N3O3.C9H13NOS/c1-3-21-4-9-23(10-5-21)24-13-15-25(16-14-24)27-18-31-29(32-19-27)26-11-6-22(7-12-26)8-17-28(34)33-20(2)30(35)36;1-9(2,3)7-5-4-6(12-7)8(10)11/h6-7,11-16,18-21,23H,3-5,8-10,17H2,1-2H3,(H,33,34)(H,35,36);4-5H,1-3H3,(H2,10,11)/t20-,21?,23?;/m1./s1 |
| InChIKey | AOBNERXUDAJWLY-LTLBKSJRSA-N |
| XLogP | 8.16 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.90 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |