C28H30Cl2N4 — CID 145099318
4-N-[2-[3-(3,5-dichlorophenyl)phenyl]-8-methylquinazolin-4-yl]-1-N-ethylpentane-1,4-diamine (PubChem CID 145099318) has the molecular formula C28H30Cl2N4 and a molecular weight of 493.48 g/mol. Its IUPAC name is 4-N-[2-[3-(3,5-dichlorophenyl)phenyl]-8-methylquinazolin-4-yl]-1-N-ethylpentane-1,4-diamine.
| Compound Name | 4-N-[2-[3-(3,5-dichlorophenyl)phenyl]-8-methylquinazolin-4-yl]-1-N-ethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 145099318 |
| Molecular Formula | C28H30Cl2N4 |
| Molecular Weight | 493.48 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-N-[2-[3-(3,5-dichlorophenyl)phenyl]-8-methylquinazolin-4-yl]-1-N-ethylpentane-1,4-diamine |
| SMILES | CCNCCCC(C)Nc1nc(-c2cccc(-c3cc(Cl)cc(Cl)c3)c2)nc2c(C)cccc12 |
| InChI | InChI=1S/C28H30Cl2N4/c1-4-31-13-7-9-19(3)32-28-25-12-5-8-18(2)26(25)33-27(34-28)21-11-6-10-20(14-21)22-15-23(29)17-24(30)16-22/h5-6,8,10-12,14-17,19,31H,4,7,9,13H2,1-3H3,(H,32,33,34) |
| InChIKey | ICCKHHCVBYXUSY-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.48 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|