C26H32BrF3N4 — CID 145099327
2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-N-(3-piperidin-1-ylpropyl)quinazolin-4-amine;ethane (PubChem CID 145099327) has the molecular formula C26H32BrF3N4 and a molecular weight of 537.47 g/mol. Its IUPAC name is 2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-N-(3-piperidin-1-ylpropyl)quinazolin-4-amine;ethane.
| Compound Name | 2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-N-(3-piperidin-1-ylpropyl)quinazolin-4-amine;ethane |
|---|---|
| PubChem CID | 145099327 |
| Molecular Formula | C26H32BrF3N4 |
| Molecular Weight | 537.47 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-[3-bromo-5-(trifluoromethyl)phenyl]-8-methyl-N-(3-piperidin-1-ylpropyl)quinazolin-4-amine;ethane |
| SMILES | CC.Cc1cccc2c(NCCCN3CCCCC3)nc(-c3cc(Br)cc(C(F)(F)F)c3)nc12 |
| InChI | InChI=1S/C24H26BrF3N4.C2H6/c1-16-7-5-8-20-21(16)30-22(17-13-18(24(26,27)28)15-19(25)14-17)31-23(20)29-9-6-12-32-10-3-2-4-11-32;1-2/h5,7-8,13-15H,2-4,6,9-12H2,1H3,(H,29,30,31);1-2H3 |
| InChIKey | CLRULTUCEDDOKR-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.47 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|