C22H27ClFN3O2 — CID 145099614
3-(7-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]-N-formylpropanamide;ethane;methanamine (PubChem CID 145099614) has the molecular formula C22H27ClFN3O2 and a molecular weight of 419.93 g/mol. Its IUPAC name is 3-(7-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]-N-formylpropanamide;ethane;methanamine.
| Compound Name | 3-(7-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]-N-formylpropanamide;ethane;methanamine |
|---|---|
| PubChem CID | 145099614 |
| Molecular Formula | C22H27ClFN3O2 |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 3-(7-chloro-1H-indol-3-yl)-N-[(4-fluorophenyl)methyl]-N-formylpropanamide;ethane;methanamine |
| SMILES | CC.CN.O=CN(Cc1ccc(F)cc1)C(=O)CCc1c[nH]c2c(Cl)cccc12 |
| InChI | InChI=1S/C19H16ClFN2O2.C2H6.CH5N/c20-17-3-1-2-16-14(10-22-19(16)17)6-9-18(25)23(12-24)11-13-4-7-15(21)8-5-13;2*1-2/h1-5,7-8,10,12,22H,6,9,11H2;1-2H3;2H2,1H3 |
| InChIKey | QFHSZJDFYYBHIZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|