C16H31NO3 — CID 145100225
(6R)-6-amino-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;ethane;methanol (PubChem CID 145100225) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is (6R)-6-amino-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;ethane;methanol.
| Compound Name | (6R)-6-amino-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;ethane;methanol |
|---|---|
| PubChem CID | 145100225 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | (6R)-6-amino-1-methyl-3a,4,4a,5,6,7,8,8a,9,9a-decahydro-1H-benzo[f][2]benzofuran-3-one;ethane;methanol |
| SMILES | CC.CC1OC(=O)C2CC3C[C@H](N)CCC3CC12.CO |
| InChI | InChI=1S/C13H21NO2.C2H6.CH4O/c1-7-11-5-8-2-3-10(14)4-9(8)6-12(11)13(15)16-7;2*1-2/h7-12H,2-6,14H2,1H3;1-2H3;2H,1H3/t7?,8?,9?,10-,11?,12?;;/m1../s1 |
| InChIKey | VHWFZYBRJPFEPY-CLHAHXSRSA-N |
| XLogP | 2.34 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |