C16H29NO — CID 145100252
1,3,3a,4a-tetramethyl-3,4,5,6,7,8,8a,9-octahydro-1H-benzo[f][2]benzofuran-9a-amine (PubChem CID 145100252) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 1,3,3a,4a-tetramethyl-3,4,5,6,7,8,8a,9-octahydro-1H-benzo[f][2]benzofuran-9a-amine.
| Compound Name | 1,3,3a,4a-tetramethyl-3,4,5,6,7,8,8a,9-octahydro-1H-benzo[f][2]benzofuran-9a-amine |
|---|---|
| PubChem CID | 145100252 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 1,3,3a,4a-tetramethyl-3,4,5,6,7,8,8a,9-octahydro-1H-benzo[f][2]benzofuran-9a-amine |
| SMILES | CC1OC(C)C2(N)CC3CCCCC3(C)CC12C |
| InChI | InChI=1S/C16H29NO/c1-11-15(4)10-14(3)8-6-5-7-13(14)9-16(15,17)12(2)18-11/h11-13H,5-10,17H2,1-4H3 |
| InChIKey | UCFXSQFIYHJHRE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |