C18H22F3N5O — CID 145100358
5-(6-tert-butyl-2-morpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 145100358) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is 5-(6-tert-butyl-2-morpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-(6-tert-butyl-2-morpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145100358 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 5-(6-tert-butyl-2-morpholin-4-ylpyrimidin-4-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(C)c1cc(-c2cnc(N)cc2C(F)(F)F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H22F3N5O/c1-17(2,3)14-9-13(24-16(25-14)26-4-6-27-7-5-26)11-10-23-15(22)8-12(11)18(19,20)21/h8-10H,4-7H2,1-3H3,(H2,22,23) |
| InChIKey | GIJZZPGHSPXGNC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |