C14H22BF3N2O2 — CID 145100404
ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 145100404) has the molecular formula C14H22BF3N2O2 and a molecular weight of 318.15 g/mol. Its IUPAC name is ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145100404 |
| Molecular Formula | C14H22BF3N2O2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | ethane;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC.CC1(C)OB(c2cnc(N)cc2C(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C12H16BF3N2O2.C2H6/c1-10(2)11(3,4)20-13(19-10)8-6-18-9(17)5-7(8)12(14,15)16;1-2/h5-6H,1-4H3,(H2,17,18);1-2H3 |
| InChIKey | XRDBBMXMVPGOQA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|