C18H26O2 — CID 145101018
1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethanone (PubChem CID 145101018) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethanone.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethanone |
|---|---|
| PubChem CID | 145101018 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]ethanone |
| SMILES | CC(C)=CCC/C(C)=C/COCC(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C18H26O2/c1-15(2)8-7-9-16(3)12-13-20-14-18(19)17-10-5-4-6-11-17/h5,8,10-12H,4,6-7,9,13-14H2,1-3H3/b16-12+ |
| InChIKey | AHWXBMVBHYNQIC-FOWTUZBSSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|