C19H28O2 — CID 145101020
1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one (PubChem CID 145101020) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one |
|---|---|
| PubChem CID | 145101020 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-2-[(2E)-3,7-dimethylocta-2,6-dienoxy]propan-1-one |
| SMILES | CC(C)=CCC/C(C)=C/COC(C)C(=O)C1=CCCC=C1 |
| InChI | InChI=1S/C19H28O2/c1-15(2)9-8-10-16(3)13-14-21-17(4)19(20)18-11-6-5-7-12-18/h6,9,11-13,17H,5,7-8,10,14H2,1-4H3/b16-13+ |
| InChIKey | UXHDFXNEDWBDBD-DTQAZKPQSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|