About (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine
(NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine (PubChem CID 145101170) has the molecular formula C18H14F2N2S
and a molecular weight of 328.39 g/mol. Its IUPAC name is (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine |
| PubChem CID | 145101170 |
| Molecular Formula | C18H14F2N2S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine |
| SMILES | Fc1ccc(F)c(-c2cc(/C=N/S)n(Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C18H14F2N2S/c19-15-6-7-18(20)17(9-15)14-8-16(10-21-23)22(12-14)11-13-4-2-1-3-5-13/h1-10,12,23H,11H2/b21-10+ |
| InChIKey | GKOGCYZOSFKDGY-UFFVCSGVSA-N |
| XLogP | 4.75 |
| TPSA | 17.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine?
The IUPAC name of (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine (CID 145101170) is (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine.
What is the SMILES notation for (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine?
The canonical SMILES for (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine is Fc1ccc(F)c(-c2cc(/C=N/S)n(Cc3ccccc3)c2)c1.
What is the InChIKey of (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine?
The InChIKey is GKOGCYZOSFKDGY-UFFVCSGVSA-N. The full InChI is InChI=1S/C18H14F2N2S/c19-15-6-7-18(20)17(9-15)14-8-16(10-21-23)22(12-14)11-13-4-2-1-3-5-13/h1-10,12,23H,11H2/b21-10+.
What are the key properties of (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine?
(NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine has a molecular weight of 328.39 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]methylidene]thiohydroxylamine is sourced from PubChem (CID 145101170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).