C39H57F2N5O4 — CID 145101185
4-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]-2-(methylamino)butanamide;N-butylformamide;cyclopentane (PubChem CID 145101185) has the molecular formula C39H57F2N5O4 and a molecular weight of 697.91 g/mol. Its IUPAC name is 4-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]-2-(methylamino)butanamide;N-butylformamide;cyclopentane.
| Compound Name | 4-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]-2-(methylamino)butanamide;N-butylformamide;cyclopentane |
|---|---|
| PubChem CID | 145101185 |
| Molecular Formula | C39H57F2N5O4 |
| Molecular Weight | 697.91 g/mol |
| Exact Mass | 697.44 |
| IUPAC Name | 4-[[1-[1-benzyl-4-(2,5-difluorophenyl)pyrrol-2-yl]-2,2-dimethylpropyl]-(2-hydroxyacetyl)amino]-2-(methylamino)butanamide;N-butylformamide;cyclopentane |
| SMILES | C1CCCC1.CCCCNC=O.CNC(CCN(C(=O)CO)C(c1cc(-c2cc(F)ccc2F)cn1Cc1ccccc1)C(C)(C)C)C(N)=O |
| InChI | InChI=1S/C29H36F2N4O3.C5H11NO.C5H10/c1-29(2,3)27(35(26(37)18-36)13-12-24(33-4)28(32)38)25-14-20(22-15-21(30)10-11-23(22)31)17-34(25)16-19-8-6-5-7-9-19;1-2-3-4-6-5-7;1-2-4-5-3-1/h5-11,14-15,17,24,27,33,36H,12-13,16,18H2,1-4H3,(H2,32,38);5H,2-4H2,1H3,(H,6,7);1-5H2 |
| InChIKey | STDYSMWAXOKLKF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.91 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|