About [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite
[2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite (PubChem CID 145101567) has the molecular formula C12H6BrFN2O3S
and a molecular weight of 357.16 g/mol. Its IUPAC name is [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite |
| PubChem CID | 145101567 |
| Molecular Formula | C12H6BrFN2O3S |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite |
| SMILES | O=C(CBr)c1nc2c(=O)oc3ccccc3c2n1SF |
| InChI | InChI=1S/C12H6BrFN2O3S/c13-5-7(17)11-15-9-10(16(11)20-14)6-3-1-2-4-8(6)19-12(9)18/h1-4H,5H2 |
| InChIKey | MGXBMTODPQNTSY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The IUPAC name of [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite (CID 145101567) is [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite.
What is the SMILES notation for [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The canonical SMILES for [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite is O=C(CBr)c1nc2c(=O)oc3ccccc3c2n1SF.
What is the InChIKey of [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The InChIKey is MGXBMTODPQNTSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrFN2O3S/c13-5-7(17)11-15-9-10(16(11)20-14)6-3-1-2-4-8(6)19-12(9)18/h1-4H,5H2.
What are the key properties of [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
[2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite has a molecular weight of 357.16 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-bromoacetyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite is sourced from PubChem (CID 145101567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).