About [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite
[2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite (PubChem CID 145101572) has the molecular formula C14H11FN2O3S
and a molecular weight of 306.32 g/mol. Its IUPAC name is [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite |
| PubChem CID | 145101572 |
| Molecular Formula | C14H11FN2O3S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite |
| SMILES | C=C(OCC)c1nc2c(=O)oc3ccccc3c2n1SF |
| InChI | InChI=1S/C14H11FN2O3S/c1-3-19-8(2)13-16-11-12(17(13)21-15)9-6-4-5-7-10(9)20-14(11)18/h4-7H,2-3H2,1H3 |
| InChIKey | AWAUVEFXQYUVHQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The IUPAC name of [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite (CID 145101572) is [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite.
What is the SMILES notation for [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The canonical SMILES for [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite is C=C(OCC)c1nc2c(=O)oc3ccccc3c2n1SF.
What is the InChIKey of [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
The InChIKey is AWAUVEFXQYUVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O3S/c1-3-19-8(2)13-16-11-12(17(13)21-15)9-6-4-5-7-10(9)20-14(11)18/h4-7H,2-3H2,1H3.
What are the key properties of [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite?
[2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite has a molecular weight of 306.32 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-ethoxyethenyl)-4-oxochromeno[3,4-d]imidazol-1-yl] thiohypofluorite is sourced from PubChem (CID 145101572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).