C23H29F2N3OS+2 — CID 145101846
[2,5-difluoro-4-[1-(2-oxo-1H-imidazol-3-yl)ethyl]phenyl]methyl-[(4R)-4-methylsulfonio-4-phenylbutyl]azanium (PubChem CID 145101846) has the molecular formula C23H29F2N3OS+2 and a molecular weight of 433.57 g/mol. Its IUPAC name is [2,5-difluoro-4-[1-(2-oxo-1H-imidazol-3-yl)ethyl]phenyl]methyl-[(4R)-4-methylsulfonio-4-phenylbutyl]azanium.
| Compound Name | [2,5-difluoro-4-[1-(2-oxo-1H-imidazol-3-yl)ethyl]phenyl]methyl-[(4R)-4-methylsulfonio-4-phenylbutyl]azanium |
|---|---|
| PubChem CID | 145101846 |
| Molecular Formula | C23H29F2N3OS+2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [2,5-difluoro-4-[1-(2-oxo-1H-imidazol-3-yl)ethyl]phenyl]methyl-[(4R)-4-methylsulfonio-4-phenylbutyl]azanium |
| SMILES | C[SH+][C@H](CCC[NH2+]Cc1cc(F)c(C(C)n2cc[nH]c2=O)cc1F)c1ccccc1 |
| InChI | InChI=1S/C23H27F2N3OS/c1-16(28-12-11-27-23(28)29)19-14-20(24)18(13-21(19)25)15-26-10-6-9-22(30-2)17-7-4-3-5-8-17/h3-5,7-8,11-14,16,22,26H,6,9-10,15H2,1-2H3,(H,27,29)/p+2/t16?,22-/m1/s1 |
| InChIKey | IUAZKMVNHVNDGB-VXNXSFHZSA-P |
| XLogP | 3.09 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|