About ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene
ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene (PubChem CID 145102650) has the molecular formula C23H30O3
and a molecular weight of 354.49 g/mol. Its IUPAC name is ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene.
Molecular Properties
| Compound Name | ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene |
| PubChem CID | 145102650 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene |
| SMILES | C=CC.CC.COc1cc(C2=C(C)c3cc(O)ccc3OC2)ccc1C |
| InChI | InChI=1S/C18H18O3.C3H6.C2H6/c1-11-4-5-13(8-18(11)20-3)16-10-21-17-7-6-14(19)9-15(17)12(16)2;1-3-2;1-2/h4-9,19H,10H2,1-3H3;3H,1H2,2H3;1-2H3 |
| InChIKey | CMCPRSMLQQPNBX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene?
The IUPAC name of ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene (CID 145102650) is ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene.
What is the SMILES notation for ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene?
The canonical SMILES for ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene is C=CC.CC.COc1cc(C2=C(C)c3cc(O)ccc3OC2)ccc1C.
What is the InChIKey of ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene?
The InChIKey is CMCPRSMLQQPNBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3.C3H6.C2H6/c1-11-4-5-13(8-18(11)20-3)16-10-21-17-7-6-14(19)9-15(17)12(16)2;1-3-2;1-2/h4-9,19H,10H2,1-3H3;3H,1H2,2H3;1-2H3.
What are the key properties of ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene?
ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene has a molecular weight of 354.49 g/mol, XLogP of 6.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-(3-methoxy-4-methylphenyl)-4-methyl-2H-chromen-6-ol;prop-1-ene is sourced from PubChem (CID 145102650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).