C32H41N5O2 — CID 145102735
ethane;4-[(2-methoxy-7-methylbenzo[b][1,5]naphthyridin-10-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol (PubChem CID 145102735) has the molecular formula C32H41N5O2 and a molecular weight of 527.71 g/mol. Its IUPAC name is ethane;4-[(2-methoxy-7-methylbenzo[b][1,5]naphthyridin-10-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol.
| Compound Name | ethane;4-[(2-methoxy-7-methylbenzo[b][1,5]naphthyridin-10-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol |
|---|---|
| PubChem CID | 145102735 |
| Molecular Formula | C32H41N5O2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | ethane;4-[(2-methoxy-7-methylbenzo[b][1,5]naphthyridin-10-yl)amino]-2,6-bis(pyrrolidin-1-ylmethyl)phenol |
| SMILES | CC.COc1ccc2nc3cc(C)ccc3c(Nc3cc(CN4CCCC4)c(O)c(CN4CCCC4)c3)c2n1 |
| InChI | InChI=1S/C30H35N5O2.C2H6/c1-20-7-8-24-26(15-20)32-25-9-10-27(37-2)33-29(25)28(24)31-23-16-21(18-34-11-3-4-12-34)30(36)22(17-23)19-35-13-5-6-14-35;1-2/h7-10,15-17,36H,3-6,11-14,18-19H2,1-2H3,(H,31,32);1-2H3 |
| InChIKey | GIJJZKMHXVSFBA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 73.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|