C18H15F2N5S — CID 145104153
4-[6-(2,5-difluorophenyl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine (PubChem CID 145104153) has the molecular formula C18H15F2N5S and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-[6-(2,5-difluorophenyl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[6-(2,5-difluorophenyl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 145104153 |
| Molecular Formula | C18H15F2N5S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 4-[6-(2,5-difluorophenyl)-2-pyridinyl]-N-(1,4,5,6-tetrahydropyrimidin-2-yl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(F)c(-c2cccc(-c3csc(NC4=NCCCN4)n3)n2)c1 |
| InChI | InChI=1S/C18H15F2N5S/c19-11-5-6-13(20)12(9-11)14-3-1-4-15(23-14)16-10-26-18(24-16)25-17-21-7-2-8-22-17/h1,3-6,9-10H,2,7-8H2,(H2,21,22,24,25) |
| InChIKey | OIEXFELTFKGVKO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |