C18H13ClN4O2S — CID 14510431
3-amino-4-(4-chlorophenyl)-6-(furan-2-yl)thieno[2,3-b]pyridine-2-carbohydrazide (PubChem CID 14510431) has the molecular formula C18H13ClN4O2S and a molecular weight of 384.85 g/mol. Its IUPAC name is 3-amino-4-(4-chlorophenyl)-6-(furan-2-yl)thieno[2,3-b]pyridine-2-carbohydrazide.
| Compound Name | 3-amino-4-(4-chlorophenyl)-6-(furan-2-yl)thieno[2,3-b]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 14510431 |
| Molecular Formula | C18H13ClN4O2S |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | 3-amino-4-(4-chlorophenyl)-6-(furan-2-yl)thieno[2,3-b]pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1sc2nc(-c3ccco3)cc(-c3ccc(Cl)cc3)c2c1N |
| InChI | InChI=1S/C18H13ClN4O2S/c19-10-5-3-9(4-6-10)11-8-12(13-2-1-7-25-13)22-18-14(11)15(20)16(26-18)17(24)23-21/h1-8H,20-21H2,(H,23,24) |
| InChIKey | SZTNPZKARKPRLM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|