C15H21FN4S — CID 145104729
N-(1,3-diazinan-2-yl)-4-(2-fluorophenyl)-1,3-thiazol-2-amine;ethane (PubChem CID 145104729) has the molecular formula C15H21FN4S and a molecular weight of 308.43 g/mol. Its IUPAC name is N-(1,3-diazinan-2-yl)-4-(2-fluorophenyl)-1,3-thiazol-2-amine;ethane.
| Compound Name | N-(1,3-diazinan-2-yl)-4-(2-fluorophenyl)-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 145104729 |
| Molecular Formula | C15H21FN4S |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-(1,3-diazinan-2-yl)-4-(2-fluorophenyl)-1,3-thiazol-2-amine;ethane |
| SMILES | CC.Fc1ccccc1-c1csc(NC2NCCCN2)n1 |
| InChI | InChI=1S/C13H15FN4S.C2H6/c14-10-5-2-1-4-9(10)11-8-19-13(17-11)18-12-15-6-3-7-16-12;1-2/h1-2,4-5,8,12,15-16H,3,6-7H2,(H,17,18);1-2H3 |
| InChIKey | IVNOMHWNVBILKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |