C9H13F3O4 — CID 145105698
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 2,2,2-trifluoroacetate;methane (PubChem CID 145105698) has the molecular formula C9H13F3O4 and a molecular weight of 242.19 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 2,2,2-trifluoroacetate;methane.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 2,2,2-trifluoroacetate;methane |
|---|---|
| PubChem CID | 145105698 |
| Molecular Formula | C9H13F3O4 |
| Molecular Weight | 242.19 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 2,2,2-trifluoroacetate;methane |
| SMILES | C.O=C(OC1COC2CCOC21)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O4.CH4/c9-8(10,11)7(12)15-5-3-14-4-1-2-13-6(4)5;/h4-6H,1-3H2;1H4 |
| InChIKey | ODWPQDLTLURKLH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |