C8H9F3O4 — CID 145105701
[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2,2-trifluoroacetate (PubChem CID 145105701) has the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. Its IUPAC name is [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 145105701 |
| Molecular Formula | C8H9F3O4 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | [(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@@H]1COC2CCOC21)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O4/c9-8(10,11)7(12)15-5-3-14-4-1-2-13-6(4)5/h4-6H,1-3H2/t4?,5-,6?/m1/s1 |
| InChIKey | XAALUOSDJABWSK-INWUZDNDSA-N |
| XLogP | 0.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |