C8H11F3O4 — CID 145105707
(3aR,6aR)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 145105707) has the molecular formula C8H11F3O4 and a molecular weight of 228.17 g/mol. Its IUPAC name is (3aR,6aR)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3aR,6aR)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 145105707 |
| Molecular Formula | C8H11F3O4 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (3aR,6aR)-6-(2,2,2-trifluoroethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OC1CO[C@@H]2C(OCC(F)(F)F)CO[C@H]12 |
| InChI | InChI=1S/C8H11F3O4/c9-8(10,11)3-15-5-2-14-6-4(12)1-13-7(5)6/h4-7,12H,1-3H2/t4?,5?,6-,7-/m1/s1 |
| InChIKey | XUWJDQJCIFLJFR-TVVDDFTJSA-N |
| XLogP | 0.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |