C7H9F3O3S — CID 145105708
(3aR,6aS)-6-(trifluoromethylsulfanyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 145105708) has the molecular formula C7H9F3O3S and a molecular weight of 230.21 g/mol. Its IUPAC name is (3aR,6aS)-6-(trifluoromethylsulfanyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (3aR,6aS)-6-(trifluoromethylsulfanyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 145105708 |
| Molecular Formula | C7H9F3O3S |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | (3aR,6aS)-6-(trifluoromethylsulfanyloxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | FC(F)(F)SOC1CO[C@@H]2CCO[C@H]12 |
| InChI | InChI=1S/C7H9F3O3S/c8-7(9,10)14-13-5-3-12-4-1-2-11-6(4)5/h4-6H,1-3H2/t4-,5?,6+/m1/s1 |
| InChIKey | MUEXNXLEARGOKN-QBQQJPCDSA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|