About (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine
(3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine (PubChem CID 145106071) has the molecular formula C13H19F2NO
and a molecular weight of 243.30 g/mol. Its IUPAC name is (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine |
| PubChem CID | 145106071 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine |
| SMILES | C=C/C(F)=C(/CN1CC[C@@H](OCC)C1)C(=C)F |
| InChI | InChI=1S/C13H19F2NO/c1-4-13(15)12(10(3)14)9-16-7-6-11(8-16)17-5-2/h4,11H,1,3,5-9H2,2H3/b13-12+/t11-/m1/s1 |
| InChIKey | CVUWFPBBAUIZJG-GXZRWPEMSA-N |
| XLogP | 2.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine?
The IUPAC name of (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine (CID 145106071) is (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine.
What is the SMILES notation for (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine?
The canonical SMILES for (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine is C=C/C(F)=C(/CN1CC[C@@H](OCC)C1)C(=C)F.
What is the InChIKey of (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine?
The InChIKey is CVUWFPBBAUIZJG-GXZRWPEMSA-N. The full InChI is InChI=1S/C13H19F2NO/c1-4-13(15)12(10(3)14)9-16-7-6-11(8-16)17-5-2/h4,11H,1,3,5-9H2,2H3/b13-12+/t11-/m1/s1.
What are the key properties of (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine?
(3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine has a molecular weight of 243.30 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-ethoxy-1-[(2E)-3-fluoro-2-(1-fluoroethenyl)penta-2,4-dienyl]pyrrolidine is sourced from PubChem (CID 145106071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).