C12H23NS — CID 14510648
5-methyl-2-(3,4,4-trimethylpent-1-en-3-yl)-1,3-thiazolidine (PubChem CID 14510648) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 5-methyl-2-(3,4,4-trimethylpent-1-en-3-yl)-1,3-thiazolidine.
| Compound Name | 5-methyl-2-(3,4,4-trimethylpent-1-en-3-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 14510648 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 5-methyl-2-(3,4,4-trimethylpent-1-en-3-yl)-1,3-thiazolidine |
| SMILES | C=CC(C)(C1NCC(C)S1)C(C)(C)C |
| InChI | InChI=1S/C12H23NS/c1-7-12(6,11(3,4)5)10-13-8-9(2)14-10/h7,9-10,13H,1,8H2,2-6H3 |
| InChIKey | SBNVLWLLUYCLKA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|