C26H22F3N3O3S — CID 145107166
(E)-3-(6-amino-3-pyridinyl)-N-[[5-(4-formylphenyl)-7-(trifluoromethyl)-1-benzothiophen-2-yl]methyl]prop-2-enamide;methanol (PubChem CID 145107166) has the molecular formula C26H22F3N3O3S and a molecular weight of 513.54 g/mol. Its IUPAC name is (E)-3-(6-amino-3-pyridinyl)-N-[[5-(4-formylphenyl)-7-(trifluoromethyl)-1-benzothiophen-2-yl]methyl]prop-2-enamide;methanol.
| Compound Name | (E)-3-(6-amino-3-pyridinyl)-N-[[5-(4-formylphenyl)-7-(trifluoromethyl)-1-benzothiophen-2-yl]methyl]prop-2-enamide;methanol |
|---|---|
| PubChem CID | 145107166 |
| Molecular Formula | C26H22F3N3O3S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (E)-3-(6-amino-3-pyridinyl)-N-[[5-(4-formylphenyl)-7-(trifluoromethyl)-1-benzothiophen-2-yl]methyl]prop-2-enamide;methanol |
| SMILES | CO.Nc1ccc(/C=C/C(=O)NCc2cc3cc(-c4ccc(C=O)cc4)cc(C(F)(F)F)c3s2)cn1 |
| InChI | InChI=1S/C25H18F3N3O2S.CH4O/c26-25(27,28)21-11-18(17-5-1-16(14-32)2-6-17)9-19-10-20(34-24(19)21)13-31-23(33)8-4-15-3-7-22(29)30-12-15;1-2/h1-12,14H,13H2,(H2,29,30)(H,31,33);2H,1H3/b8-4+; |
| InChIKey | BDVJLLLWNZRUHI-ZFXMFRGYSA-N |
| XLogP | 5.31 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|