C22H15BrO2 — CID 145107605
8-bromo-2-[(1S)-2-methylcyclopropyl]tetracene-5,12-dione (PubChem CID 145107605) has the molecular formula C22H15BrO2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 8-bromo-2-[(1S)-2-methylcyclopropyl]tetracene-5,12-dione.
| Compound Name | 8-bromo-2-[(1S)-2-methylcyclopropyl]tetracene-5,12-dione |
|---|---|
| PubChem CID | 145107605 |
| Molecular Formula | C22H15BrO2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 8-bromo-2-[(1S)-2-methylcyclopropyl]tetracene-5,12-dione |
| SMILES | CC1C[C@@H]1c1ccc2c(c1)C(=O)c1cc3ccc(Br)cc3cc1C2=O |
| InChI | InChI=1S/C22H15BrO2/c1-11-6-17(11)13-3-5-16-18(9-13)22(25)19-8-12-2-4-15(23)7-14(12)10-20(19)21(16)24/h2-5,7-11,17H,6H2,1H3/t11?,17-/m0/s1 |
| InChIKey | XRBQNAXPHINYHS-KLLZUTDZSA-N |
| XLogP | 5.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|