C19H30F2O2 — CID 145107628
(Z)-10-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxy-5-propyldec-3-en-4-ol (PubChem CID 145107628) has the molecular formula C19H30F2O2 and a molecular weight of 328.44 g/mol. Its IUPAC name is (Z)-10-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxy-5-propyldec-3-en-4-ol.
| Compound Name | (Z)-10-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxy-5-propyldec-3-en-4-ol |
|---|---|
| PubChem CID | 145107628 |
| Molecular Formula | C19H30F2O2 |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (Z)-10-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxy-5-propyldec-3-en-4-ol |
| SMILES | C=C(F)/C=C(/OCCCCCC(CCC)/C(O)=C/CC)C(=C)F |
| InChI | InChI=1S/C19H30F2O2/c1-5-10-17(18(22)11-6-2)12-8-7-9-13-23-19(16(4)21)14-15(3)20/h11,14,17,22H,3-10,12-13H2,1-2H3/b18-11-,19-14+ |
| InChIKey | NHKKHDQHBZGXOR-ZKVVTGIPSA-N |
| XLogP | 6.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|