About ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol
ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol (PubChem CID 145107635) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol |
| PubChem CID | 145107635 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol |
| SMILES | C=C/C=C(\C=C)OCCN1CCC(CO)CC1.CC |
| InChI | InChI=1S/C14H23NO2.C2H6/c1-3-5-14(4-2)17-11-10-15-8-6-13(12-16)7-9-15;1-2/h3-5,13,16H,1-2,6-12H2;1-2H3/b14-5+; |
| InChIKey | NCWYCWSNSGOYFI-OCSIRBNJSA-N |
| XLogP | 2.99 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol?
The IUPAC name of ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol (CID 145107635) is ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol.
What is the SMILES notation for ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol?
The canonical SMILES for ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol is C=C/C=C(\C=C)OCCN1CCC(CO)CC1.CC.
What is the InChIKey of ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol?
The InChIKey is NCWYCWSNSGOYFI-OCSIRBNJSA-N. The full InChI is InChI=1S/C14H23NO2.C2H6/c1-3-5-14(4-2)17-11-10-15-8-6-13(12-16)7-9-15;1-2/h3-5,13,16H,1-2,6-12H2;1-2H3/b14-5+;.
What are the key properties of ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol?
ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol has a molecular weight of 267.41 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[1-[2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methanol is sourced from PubChem (CID 145107635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).