C27H36ClF2N3O — CID 145107767
(Z)-1-(4-chlorophenyl)-N-[[1-[2-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine (PubChem CID 145107767) has the molecular formula C27H36ClF2N3O and a molecular weight of 492.05 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-[[1-[2-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-[[1-[2-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine |
|---|---|
| PubChem CID | 145107767 |
| Molecular Formula | C27H36ClF2N3O |
| Molecular Weight | 492.05 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-[[1-[2-[(3E)-2,5-difluorohexa-1,3,5-trien-3-yl]oxyethyl]piperidin-4-yl]methyl]-2-methyliminohex-3-en-1-amine |
| SMILES | C=C(F)/C=C(/OCCN1CCC(CNC(C(/C=C\CC)=N/C)c2ccc(Cl)cc2)CC1)C(=C)F |
| InChI | InChI=1S/C27H36ClF2N3O/c1-5-6-7-25(31-4)27(23-8-10-24(28)11-9-23)32-19-22-12-14-33(15-13-22)16-17-34-26(21(3)30)18-20(2)29/h6-11,18,22,27,32H,2-3,5,12-17,19H2,1,4H3/b7-6-,26-18+,31-25+ |
| InChIKey | YFDCJLUPKUGNNS-RWISBZRYSA-N |
| XLogP | 6.59 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.05 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|