C28H50F3NO — CID 145108002
4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine;methylcyclohexane;2-methylpropane (PubChem CID 145108002) has the molecular formula C28H50F3NO and a molecular weight of 473.71 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine;methylcyclohexane;2-methylpropane.
| Compound Name | 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine;methylcyclohexane;2-methylpropane |
|---|---|
| PubChem CID | 145108002 |
| Molecular Formula | C28H50F3NO |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 473.38 |
| IUPAC Name | 4,4-dimethyl-1-[2-[(2E,4E)-4-(trifluoromethyl)hepta-2,4,6-trien-3-yl]oxyethyl]piperidine;methylcyclohexane;2-methylpropane |
| SMILES | C=C/C=C(C(=C/C)\OCCN1CCC(C)(C)CC1)/C(F)(F)F.CC(C)C.CC1CCCCC1 |
| InChI | InChI=1S/C17H26F3NO.C7H14.C4H10/c1-5-7-14(17(18,19)20)15(6-2)22-13-12-21-10-8-16(3,4)9-11-21;1-7-5-3-2-4-6-7;1-4(2)3/h5-7H,1,8-13H2,2-4H3;7H,2-6H2,1H3;4H,1-3H3/b14-7+,15-6+;; |
| InChIKey | RNWVJLNCAYIPHP-MUQJANMTSA-N |
| XLogP | 8.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|